C23H33IN4O — CID 111053542
2-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide (PubChem CID 111053542) has the molecular formula C23H33IN4O and a molecular weight of 508.45 g/mol. Its IUPAC name is 2-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111053542 |
| Molecular Formula | C23H33IN4O |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 2-[[4-[(3,5-dimethylpiperidin-1-yl)methyl]phenyl]methyl]-1-(4-methoxyphenyl)guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2ccc(CN3CC(C)CC(C)C3)cc2)cc1.I |
| InChI | InChI=1S/C23H32N4O.HI/c1-17-12-18(2)15-27(14-17)16-20-6-4-19(5-7-20)13-25-23(24)26-21-8-10-22(28-3)11-9-21;/h4-11,17-18H,12-16H2,1-3H3,(H3,24,25,26);1H |
| InChIKey | FNBAXCHDUOFELM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|