C23H32N4O2 — CID 111047020
1-(3,4-dimethoxyphenyl)-2-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111047020) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111047020 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[[4-[(4-methylpiperidin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/Cc2ccc(CN3CCC(C)CC3)cc2)cc1OC |
| InChI | InChI=1S/C23H32N4O2/c1-17-10-12-27(13-11-17)16-19-6-4-18(5-7-19)15-25-23(24)26-20-8-9-21(28-2)22(14-20)29-3/h4-9,14,17H,10-13,15-16H2,1-3H3,(H3,24,25,26) |
| InChIKey | HLLGIGJKMBIVAZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|