C20H23N3O2 — CID 146496906
(2S)-N'-[(4-hydroxyphenyl)methyl]-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide (PubChem CID 146496906) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is (2S)-N'-[(4-hydroxyphenyl)methyl]-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide.
| Compound Name | (2S)-N'-[(4-hydroxyphenyl)methyl]-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 146496906 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (2S)-N'-[(4-hydroxyphenyl)methyl]-1-[(4-methylphenyl)methyl]-5-oxopyrrolidine-2-carboximidamide |
| SMILES | Cc1ccc(CN2C(=O)CC[C@H]2/C(N)=N/Cc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C20H23N3O2/c1-14-2-4-16(5-3-14)13-23-18(10-11-19(23)25)20(21)22-12-15-6-8-17(24)9-7-15/h2-9,18,24H,10-13H2,1H3,(H2,21,22)/t18-/m0/s1 |
| InChIKey | BHWQCLANVQAHSS-SFHVURJKSA-N |
| XLogP | 2.75 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|