C20H25NO4 — CID 56954559
ethyl (4aR,8aR)-1-[(4-methoxyphenyl)methyl]-2-oxo-3,4,4a,5,6,8a-hexahydroquinoline-7-carboxylate (PubChem CID 56954559) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is ethyl (4aR,8aR)-1-[(4-methoxyphenyl)methyl]-2-oxo-3,4,4a,5,6,8a-hexahydroquinoline-7-carboxylate.
| Compound Name | ethyl (4aR,8aR)-1-[(4-methoxyphenyl)methyl]-2-oxo-3,4,4a,5,6,8a-hexahydroquinoline-7-carboxylate |
|---|---|
| PubChem CID | 56954559 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | ethyl (4aR,8aR)-1-[(4-methoxyphenyl)methyl]-2-oxo-3,4,4a,5,6,8a-hexahydroquinoline-7-carboxylate |
| SMILES | CCOC(=O)C1=C[C@H]2[C@@H](CCC(=O)N2Cc2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C20H25NO4/c1-3-25-20(23)16-7-6-15-8-11-19(22)21(18(15)12-16)13-14-4-9-17(24-2)10-5-14/h4-5,9-10,12,15,18H,3,6-8,11,13H2,1-2H3/t15-,18+/m1/s1 |
| InChIKey | PMIGROPPXZPGFZ-QAPCUYQASA-N |
| XLogP | 3.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |