C16H23FN2O3 — CID 3042469
N-ethylethanamine;(2S)-1-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-2-carboxylic acid (PubChem CID 3042469) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is N-ethylethanamine;(2S)-1-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-2-carboxylic acid.
| Compound Name | N-ethylethanamine;(2S)-1-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 3042469 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-ethylethanamine;(2S)-1-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-2-carboxylic acid |
| SMILES | CCNCC.O=C(O)[C@@H]1CCC(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C12H12FNO3.C4H11N/c13-9-3-1-8(2-4-9)7-14-10(12(16)17)5-6-11(14)15;1-3-5-4-2/h1-4,10H,5-7H2,(H,16,17);5H,3-4H2,1-2H3/t10-;/m0./s1 |
| InChIKey | NRYXNOPHUPKROJ-PPHPATTJSA-N |
| XLogP | 2.02 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |