C24H27NO3 — CID 132821709
(6S)-1-[(4-methoxyphenyl)methyl]-6-[(E,2S)-5-oxo-5-phenylpent-3-en-2-yl]piperidin-2-one (PubChem CID 132821709) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is (6S)-1-[(4-methoxyphenyl)methyl]-6-[(E,2S)-5-oxo-5-phenylpent-3-en-2-yl]piperidin-2-one.
| Compound Name | (6S)-1-[(4-methoxyphenyl)methyl]-6-[(E,2S)-5-oxo-5-phenylpent-3-en-2-yl]piperidin-2-one |
|---|---|
| PubChem CID | 132821709 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (6S)-1-[(4-methoxyphenyl)methyl]-6-[(E,2S)-5-oxo-5-phenylpent-3-en-2-yl]piperidin-2-one |
| SMILES | COc1ccc(CN2C(=O)CCC[C@H]2[C@@H](C)/C=C/C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H27NO3/c1-18(11-16-23(26)20-7-4-3-5-8-20)22-9-6-10-24(27)25(22)17-19-12-14-21(28-2)15-13-19/h3-5,7-8,11-16,18,22H,6,9-10,17H2,1-2H3/b16-11+/t18-,22-/m0/s1 |
| InChIKey | DIGRYTHULGODDR-CNXSZJAVSA-N |
| XLogP | 4.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|