C6H11NO2 — CID 55298771
3-methyl-1,4-oxazepan-5-one (PubChem CID 55298771) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is 3-methyl-1,4-oxazepan-5-one.
| Compound Name | 3-methyl-1,4-oxazepan-5-one |
|---|---|
| PubChem CID | 55298771 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 3-methyl-1,4-oxazepan-5-one |
| SMILES | CC1COCCC(=O)N1 |
| InChI | InChI=1S/C6H11NO2/c1-5-4-9-3-2-6(8)7-5/h5H,2-4H2,1H3,(H,7,8) |
| InChIKey | ZVNKGZGAANRYQX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |