C16H28N4O4 — CID 177427940
(8S,12S,16S)-4,8,12,16-tetramethyl-1,5,9,13-tetrazacyclohexadecane-2,6,10,14-tetrone (PubChem CID 177427940) has the molecular formula C16H28N4O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is (8S,12S,16S)-4,8,12,16-tetramethyl-1,5,9,13-tetrazacyclohexadecane-2,6,10,14-tetrone.
| Compound Name | (8S,12S,16S)-4,8,12,16-tetramethyl-1,5,9,13-tetrazacyclohexadecane-2,6,10,14-tetrone |
|---|---|
| PubChem CID | 177427940 |
| Molecular Formula | C16H28N4O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | (8S,12S,16S)-4,8,12,16-tetramethyl-1,5,9,13-tetrazacyclohexadecane-2,6,10,14-tetrone |
| SMILES | CC1CC(=O)N[C@@H](C)CC(=O)N[C@@H](C)CC(=O)N[C@@H](C)CC(=O)N1 |
| InChI | InChI=1S/C16H28N4O4/c1-9-5-13(21)18-11(3)7-15(23)20-12(4)8-16(24)19-10(2)6-14(22)17-9/h9-12H,5-8H2,1-4H3,(H,17,22)(H,18,21)(H,19,24)(H,20,23)/t9-,10-,11-,12?/m0/s1 |
| InChIKey | DXJAJVYKJUTVGI-XOGOEWOHSA-N |
| XLogP | -0.42 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |