C13H21NO3 — CID 123664676
3,11,11-trimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione (PubChem CID 123664676) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 3,11,11-trimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione.
| Compound Name | 3,11,11-trimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
|---|---|
| PubChem CID | 123664676 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3,11,11-trimethyl-1-oxa-4-azacyclododec-8-ene-5,12-dione |
| SMILES | CC1COC(=O)C(C)(C)CC=CCCC(=O)N1 |
| InChI | InChI=1S/C13H21NO3/c1-10-9-17-12(16)13(2,3)8-6-4-5-7-11(15)14-10/h4,6,10H,5,7-9H2,1-3H3,(H,14,15) |
| InChIKey | RVSFVEYCBPALMC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|