4-methyl-1,3-oxazolidin-2-one;molecular hydrogen

C4H9NO2 — CID 143507654

IUPAC4-methyl-1,3-oxazolidin-2-one;molecular hydrogen
SMILESCC1COC(=O)N1.[H][H]
InChIInChI=1S/C4H7NO2.H2/c1-3-2-7-4(6)5-3;/h3H,2H2,1H3,(H,5,6);1H
InChIKeyNBVUFUMFDDSBJQ-UHFFFAOYSA-N
MW103.12 g/mol
LogP0.36
Rot. Bonds

About 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen

4-methyl-1,3-oxazolidin-2-one;molecular hydrogen (PubChem CID 143507654) has the molecular formula C4H9NO2 and a molecular weight of 103.12 g/mol. Its IUPAC name is 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen.

Molecular Properties

Compound Name4-methyl-1,3-oxazolidin-2-one;molecular hydrogen
PubChem CID143507654
Molecular FormulaC4H9NO2
Molecular Weight103.12 g/mol
Exact Mass103.06
IUPAC Name4-methyl-1,3-oxazolidin-2-one;molecular hydrogen
SMILESCC1COC(=O)N1.[H][H]
InChIInChI=1S/C4H7NO2.H2/c1-3-2-7-4(6)5-3;/h3H,2H2,1H3,(H,5,6);1H
InChIKeyNBVUFUMFDDSBJQ-UHFFFAOYSA-N
XLogP0.36
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500103.12
LogP ≤ 50.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen?
The IUPAC name of 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen (CID 143507654) is 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen.
What is the SMILES notation for 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen?
The canonical SMILES for 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen is CC1COC(=O)N1.[H][H].
What is the InChIKey of 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen?
The InChIKey is NBVUFUMFDDSBJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2.H2/c1-3-2-7-4(6)5-3;/h3H,2H2,1H3,(H,5,6);1H.
What are the key properties of 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen?
4-methyl-1,3-oxazolidin-2-one;molecular hydrogen has a molecular weight of 103.12 g/mol, XLogP of 0.36, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen is sourced from PubChem (CID 143507654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).