About 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen
4-methyl-1,3-oxazolidin-2-one;molecular hydrogen (PubChem CID 143507654) has the molecular formula C4H9NO2
and a molecular weight of 103.12 g/mol. Its IUPAC name is 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen.
Molecular Properties
| Compound Name | 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen |
| PubChem CID | 143507654 |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.12 g/mol |
| Exact Mass | 103.06 |
| IUPAC Name | 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen |
| SMILES | CC1COC(=O)N1.[H][H] |
| InChI | InChI=1S/C4H7NO2.H2/c1-3-2-7-4(6)5-3;/h3H,2H2,1H3,(H,5,6);1H |
| InChIKey | NBVUFUMFDDSBJQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.12 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen?
The IUPAC name of 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen (CID 143507654) is 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen.
What is the SMILES notation for 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen?
The canonical SMILES for 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen is CC1COC(=O)N1.[H][H].
What is the InChIKey of 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen?
The InChIKey is NBVUFUMFDDSBJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2.H2/c1-3-2-7-4(6)5-3;/h3H,2H2,1H3,(H,5,6);1H.
What are the key properties of 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen?
4-methyl-1,3-oxazolidin-2-one;molecular hydrogen has a molecular weight of 103.12 g/mol, XLogP of 0.36, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-oxazolidin-2-one;molecular hydrogen is sourced from PubChem (CID 143507654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).