C8H15NO2 — CID 143059431
4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene (PubChem CID 143059431) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene.
| Compound Name | 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene |
|---|---|
| PubChem CID | 143059431 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene |
| SMILES | C=C(C)C.CC1COC(=O)N1 |
| InChI | InChI=1S/C4H7NO2.C4H8/c1-3-2-7-4(6)5-3;1-4(2)3/h3H,2H2,1H3,(H,5,6);1H2,2-3H3 |
| InChIKey | NBVRUBXAPMYOTF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|