About 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene
4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene (PubChem CID 143059431) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene.
Molecular Properties
| Compound Name | 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene |
| PubChem CID | 143059431 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene |
| SMILES | C=C(C)C.CC1COC(=O)N1 |
| InChI | InChI=1S/C4H7NO2.C4H8/c1-3-2-7-4(6)5-3;1-4(2)3/h3H,2H2,1H3,(H,5,6);1H2,2-3H3 |
| InChIKey | NBVRUBXAPMYOTF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene?
The IUPAC name of 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene (CID 143059431) is 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene.
What is the SMILES notation for 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene?
The canonical SMILES for 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene is C=C(C)C.CC1COC(=O)N1.
What is the InChIKey of 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene?
The InChIKey is NBVRUBXAPMYOTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2.C4H8/c1-3-2-7-4(6)5-3;1-4(2)3/h3H,2H2,1H3,(H,5,6);1H2,2-3H3.
What are the key properties of 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene?
4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene has a molecular weight of 157.21 g/mol, XLogP of 1.70, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-oxazolidin-2-one;2-methylprop-1-ene is sourced from PubChem (CID 143059431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).