C4H7NO2S — CID 123293651
4-methylsulfanyl-1,3-oxazolidin-2-one (PubChem CID 123293651) has the molecular formula C4H7NO2S and a molecular weight of 133.17 g/mol. Its IUPAC name is 4-methylsulfanyl-1,3-oxazolidin-2-one.
| Compound Name | 4-methylsulfanyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 123293651 |
| Molecular Formula | C4H7NO2S |
| Molecular Weight | 133.17 g/mol |
| Exact Mass | 133.02 |
| IUPAC Name | 4-methylsulfanyl-1,3-oxazolidin-2-one |
| SMILES | CSC1COC(=O)N1 |
| InChI | InChI=1S/C4H7NO2S/c1-8-3-2-7-4(6)5-3/h3H,2H2,1H3,(H,5,6) |
| InChIKey | RSSVMBXBEURSEP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.17 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |