C5H8FNO2 — CID 139507497
4-[(1R)-1-fluoroethyl]-1,3-oxazolidin-2-one (PubChem CID 139507497) has the molecular formula C5H8FNO2 and a molecular weight of 133.12 g/mol. Its IUPAC name is 4-[(1R)-1-fluoroethyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-[(1R)-1-fluoroethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139507497 |
| Molecular Formula | C5H8FNO2 |
| Molecular Weight | 133.12 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | 4-[(1R)-1-fluoroethyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](F)C1COC(=O)N1 |
| InChI | InChI=1S/C5H8FNO2/c1-3(6)4-2-9-5(8)7-4/h3-4H,2H2,1H3,(H,7,8)/t3-,4?/m1/s1 |
| InChIKey | UCGCIGIJYBYKHV-SYPWQXSBSA-N |
| XLogP | 0.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.12 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |