C7H12ClNO2 — CID 101398831
(4R)-4-(1-chlorobutyl)-1,3-oxazolidin-2-one (PubChem CID 101398831) has the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. Its IUPAC name is (4R)-4-(1-chlorobutyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-(1-chlorobutyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101398831 |
| Molecular Formula | C7H12ClNO2 |
| Molecular Weight | 177.63 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | (4R)-4-(1-chlorobutyl)-1,3-oxazolidin-2-one |
| SMILES | CCCC(Cl)[C@H]1COC(=O)N1 |
| InChI | InChI=1S/C7H12ClNO2/c1-2-3-5(8)6-4-11-7(10)9-6/h5-6H,2-4H2,1H3,(H,9,10)/t5?,6-/m1/s1 |
| InChIKey | UVCXGLRQXDHBMK-PRJDIBJQSA-N |
| XLogP | 1.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.63 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|