C14H25NO3 — CID 130436448
(4S)-4-(2-propyloctanoyl)-1,3-oxazolidin-2-one (PubChem CID 130436448) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is (4S)-4-(2-propyloctanoyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-(2-propyloctanoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 130436448 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (4S)-4-(2-propyloctanoyl)-1,3-oxazolidin-2-one |
| SMILES | CCCCCCC(CCC)C(=O)[C@@H]1COC(=O)N1 |
| InChI | InChI=1S/C14H25NO3/c1-3-5-6-7-9-11(8-4-2)13(16)12-10-18-14(17)15-12/h11-12H,3-10H2,1-2H3,(H,15,17)/t11?,12-/m0/s1 |
| InChIKey | USJMFSZCADGFPO-KIYNQFGBSA-N |
| XLogP | 3.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|