C16H15NO3 — CID 141261165
(4R)-4-[(R)-(4-hydroxyphenyl)-phenylmethyl]-1,3-oxazolidin-2-one (PubChem CID 141261165) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is (4R)-4-[(R)-(4-hydroxyphenyl)-phenylmethyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-[(R)-(4-hydroxyphenyl)-phenylmethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 141261165 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | (4R)-4-[(R)-(4-hydroxyphenyl)-phenylmethyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@H](C(c2ccccc2)c2ccc(O)cc2)CO1 |
| InChI | InChI=1S/C16H15NO3/c18-13-8-6-12(7-9-13)15(11-4-2-1-3-5-11)14-10-20-16(19)17-14/h1-9,14-15,18H,10H2,(H,17,19)/t14-,15?/m0/s1 |
| InChIKey | CNZKVLVDAXPFBK-MLCCFXAWSA-N |
| XLogP | 2.63 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |