About 3-sulfanyloxan-4-one
3-sulfanyloxan-4-one (PubChem CID 57433279) has the molecular formula C5H8O2S
and a molecular weight of 132.18 g/mol. Its IUPAC name is 3-sulfanyloxan-4-one.
Molecular Properties
| Compound Name | 3-sulfanyloxan-4-one |
| PubChem CID | 57433279 |
| Molecular Formula | C5H8O2S |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | 3-sulfanyloxan-4-one |
| SMILES | O=C1CCOCC1S |
| InChI | InChI=1S/C5H8O2S/c6-4-1-2-7-3-5(4)8/h5,8H,1-3H2 |
| InChIKey | CYTSRCABFXBRCT-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanyloxan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanyloxan-4-one?
The IUPAC name of 3-sulfanyloxan-4-one (CID 57433279) is 3-sulfanyloxan-4-one.
What is the SMILES notation for 3-sulfanyloxan-4-one?
The canonical SMILES for 3-sulfanyloxan-4-one is O=C1CCOCC1S.
What is the InChIKey of 3-sulfanyloxan-4-one?
The InChIKey is CYTSRCABFXBRCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2S/c6-4-1-2-7-3-5(4)8/h5,8H,1-3H2.
What are the key properties of 3-sulfanyloxan-4-one?
3-sulfanyloxan-4-one has a molecular weight of 132.18 g/mol, XLogP of 0.27, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanyloxan-4-one is sourced from PubChem (CID 57433279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).