About (4-oxooxan-3-yl)carbamic acid
(4-oxooxan-3-yl)carbamic acid (PubChem CID 77441083) has the molecular formula C6H9NO4
and a molecular weight of 159.14 g/mol. Its IUPAC name is (4-oxooxan-3-yl)carbamic acid.
Molecular Properties
| Compound Name | (4-oxooxan-3-yl)carbamic acid |
| PubChem CID | 77441083 |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | (4-oxooxan-3-yl)carbamic acid |
| SMILES | O=C(O)NC1COCCC1=O |
| InChI | InChI=1S/C6H9NO4/c8-5-1-2-11-3-4(5)7-6(9)10/h4,7H,1-3H2,(H,9,10) |
| InChIKey | WYLDVDGLJSFPCG-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-oxooxan-3-yl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxooxan-3-yl)carbamic acid?
The IUPAC name of (4-oxooxan-3-yl)carbamic acid (CID 77441083) is (4-oxooxan-3-yl)carbamic acid.
What is the SMILES notation for (4-oxooxan-3-yl)carbamic acid?
The canonical SMILES for (4-oxooxan-3-yl)carbamic acid is O=C(O)NC1COCCC1=O.
What is the InChIKey of (4-oxooxan-3-yl)carbamic acid?
The InChIKey is WYLDVDGLJSFPCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO4/c8-5-1-2-11-3-4(5)7-6(9)10/h4,7H,1-3H2,(H,9,10).
What are the key properties of (4-oxooxan-3-yl)carbamic acid?
(4-oxooxan-3-yl)carbamic acid has a molecular weight of 159.14 g/mol, XLogP of -0.39, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxooxan-3-yl)carbamic acid is sourced from PubChem (CID 77441083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).