About 3-anilinooxan-4-one
3-anilinooxan-4-one (PubChem CID 175322067) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-anilinooxan-4-one.
Molecular Properties
| Compound Name | 3-anilinooxan-4-one |
| PubChem CID | 175322067 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3-anilinooxan-4-one |
| SMILES | O=C1CCOCC1Nc1ccccc1 |
| InChI | InChI=1S/C11H13NO2/c13-11-6-7-14-8-10(11)12-9-4-2-1-3-5-9/h1-5,10,12H,6-8H2 |
| InChIKey | PBNXSIQBEGRDAK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-anilinooxan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-anilinooxan-4-one?
The IUPAC name of 3-anilinooxan-4-one (CID 175322067) is 3-anilinooxan-4-one.
What is the SMILES notation for 3-anilinooxan-4-one?
The canonical SMILES for 3-anilinooxan-4-one is O=C1CCOCC1Nc1ccccc1.
What is the InChIKey of 3-anilinooxan-4-one?
The InChIKey is PBNXSIQBEGRDAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c13-11-6-7-14-8-10(11)12-9-4-2-1-3-5-9/h1-5,10,12H,6-8H2.
What are the key properties of 3-anilinooxan-4-one?
3-anilinooxan-4-one has a molecular weight of 191.23 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-anilinooxan-4-one is sourced from PubChem (CID 175322067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).