C14H19NO — CID 57175118
2-anilino-4,4-dimethylcyclohexan-1-one (PubChem CID 57175118) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-anilino-4,4-dimethylcyclohexan-1-one.
| Compound Name | 2-anilino-4,4-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 57175118 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-anilino-4,4-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CCC(=O)C(Nc2ccccc2)C1 |
| InChI | InChI=1S/C14H19NO/c1-14(2)9-8-13(16)12(10-14)15-11-6-4-3-5-7-11/h3-7,12,15H,8-10H2,1-2H3 |
| InChIKey | CBACWIRBRHDWAV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |