About [(3S)-oxan-3-yl]carbamic acid
[(3S)-oxan-3-yl]carbamic acid (PubChem CID 141364908) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is [(3S)-oxan-3-yl]carbamic acid.
Molecular Properties
| Compound Name | [(3S)-oxan-3-yl]carbamic acid |
| PubChem CID | 141364908 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | [(3S)-oxan-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@H]1CCCOC1 |
| InChI | InChI=1S/C6H11NO3/c8-6(9)7-5-2-1-3-10-4-5/h5,7H,1-4H2,(H,8,9)/t5-/m0/s1 |
| InChIKey | WAKDLOFZBIGQDW-YFKPBYRVSA-N |
| XLogP | 0.43 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3S)-oxan-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-oxan-3-yl]carbamic acid?
The IUPAC name of [(3S)-oxan-3-yl]carbamic acid (CID 141364908) is [(3S)-oxan-3-yl]carbamic acid.
What is the SMILES notation for [(3S)-oxan-3-yl]carbamic acid?
The canonical SMILES for [(3S)-oxan-3-yl]carbamic acid is O=C(O)N[C@H]1CCCOC1.
What is the InChIKey of [(3S)-oxan-3-yl]carbamic acid?
The InChIKey is WAKDLOFZBIGQDW-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H11NO3/c8-6(9)7-5-2-1-3-10-4-5/h5,7H,1-4H2,(H,8,9)/t5-/m0/s1.
What are the key properties of [(3S)-oxan-3-yl]carbamic acid?
[(3S)-oxan-3-yl]carbamic acid has a molecular weight of 145.16 g/mol, XLogP of 0.43, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-oxan-3-yl]carbamic acid is sourced from PubChem (CID 141364908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).