About N-(oxan-3-yl)acetamide
N-(oxan-3-yl)acetamide (PubChem CID 55285282) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is N-(oxan-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(oxan-3-yl)acetamide |
| PubChem CID | 55285282 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | N-(oxan-3-yl)acetamide |
| SMILES | CC(=O)NC1CCCOC1 |
| InChI | InChI=1S/C7H13NO2/c1-6(9)8-7-3-2-4-10-5-7/h7H,2-5H2,1H3,(H,8,9) |
| InChIKey | ABNUOBIFDGURCR-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(oxan-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxan-3-yl)acetamide?
The IUPAC name of N-(oxan-3-yl)acetamide (CID 55285282) is N-(oxan-3-yl)acetamide.
What is the SMILES notation for N-(oxan-3-yl)acetamide?
The canonical SMILES for N-(oxan-3-yl)acetamide is CC(=O)NC1CCCOC1.
What is the InChIKey of N-(oxan-3-yl)acetamide?
The InChIKey is ABNUOBIFDGURCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-6(9)8-7-3-2-4-10-5-7/h7H,2-5H2,1H3,(H,8,9).
What are the key properties of N-(oxan-3-yl)acetamide?
N-(oxan-3-yl)acetamide has a molecular weight of 143.19 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxan-3-yl)acetamide is sourced from PubChem (CID 55285282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).