C8H11NO5 — CID 82397360
3-(2-hydroxyethyl)-2,6-dioxopiperidine-4-carboxylic acid (PubChem CID 82397360) has the molecular formula C8H11NO5 and a molecular weight of 201.18 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-2,6-dioxopiperidine-4-carboxylic acid.
| Compound Name | 3-(2-hydroxyethyl)-2,6-dioxopiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 82397360 |
| Molecular Formula | C8H11NO5 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 3-(2-hydroxyethyl)-2,6-dioxopiperidine-4-carboxylic acid |
| SMILES | O=C1CC(C(=O)O)C(CCO)C(=O)N1 |
| InChI | InChI=1S/C8H11NO5/c10-2-1-4-5(8(13)14)3-6(11)9-7(4)12/h4-5,10H,1-3H2,(H,13,14)(H,9,11,12) |
| InChIKey | SWVUDOLRLHORFX-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|