C10H21NO2 — CID 145077035
ethane;3-methylpyrrolidine-2,5-dione;propane (PubChem CID 145077035) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is ethane;3-methylpyrrolidine-2,5-dione;propane.
| Compound Name | ethane;3-methylpyrrolidine-2,5-dione;propane |
|---|---|
| PubChem CID | 145077035 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | ethane;3-methylpyrrolidine-2,5-dione;propane |
| SMILES | CC.CC1CC(=O)NC1=O.CCC |
| InChI | InChI=1S/C5H7NO2.C3H8.C2H6/c1-3-2-4(7)6-5(3)8;1-3-2;1-2/h3H,2H2,1H3,(H,6,7,8);3H2,1-2H3;1-2H3 |
| InChIKey | QRHIYKPQJOOVJH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|