C10H14N2O3 — CID 143529364
3-methyl-5-methylidenepyrrolidin-2-one;pyrrolidine-2,5-dione (PubChem CID 143529364) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-methyl-5-methylidenepyrrolidin-2-one;pyrrolidine-2,5-dione.
| Compound Name | 3-methyl-5-methylidenepyrrolidin-2-one;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 143529364 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 3-methyl-5-methylidenepyrrolidin-2-one;pyrrolidine-2,5-dione |
| SMILES | C=C1CC(C)C(=O)N1.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C6H9NO.C4H5NO2/c1-4-3-5(2)7-6(4)8;6-3-1-2-4(7)5-3/h4H,2-3H2,1H3,(H,7,8);1-2H2,(H,5,6,7) |
| InChIKey | ACVBLIIVULRHQC-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|