About hydron;pyrrolidine-2,5-dione
hydron;pyrrolidine-2,5-dione (PubChem CID 174652792) has the molecular formula C4H6NO2+
and a molecular weight of 100.10 g/mol. Its IUPAC name is hydron;pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | hydron;pyrrolidine-2,5-dione |
| PubChem CID | 174652792 |
| Molecular Formula | C4H6NO2+ |
| Molecular Weight | 100.10 g/mol |
| Exact Mass | 100.04 |
| IUPAC Name | hydron;pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1.[H+] |
| InChI | InChI=1S/C4H5NO2/c6-3-1-2-4(7)5-3/h1-2H2,(H,5,6,7)/p+1 |
| InChIKey | KZNICNPSHKQLFF-UHFFFAOYSA-O |
| XLogP | -0.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.10 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze hydron;pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;pyrrolidine-2,5-dione?
The IUPAC name of hydron;pyrrolidine-2,5-dione (CID 174652792) is hydron;pyrrolidine-2,5-dione.
What is the SMILES notation for hydron;pyrrolidine-2,5-dione?
The canonical SMILES for hydron;pyrrolidine-2,5-dione is O=C1CCC(=O)N1.[H+].
What is the InChIKey of hydron;pyrrolidine-2,5-dione?
The InChIKey is KZNICNPSHKQLFF-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H5NO2/c6-3-1-2-4(7)5-3/h1-2H2,(H,5,6,7)/p+1.
What are the key properties of hydron;pyrrolidine-2,5-dione?
hydron;pyrrolidine-2,5-dione has a molecular weight of 100.10 g/mol, XLogP of -0.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;pyrrolidine-2,5-dione is sourced from PubChem (CID 174652792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).