C6H9NO2 — CID 225678
2,2-Dimethylsuccinimide (PubChem CID 225678) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 3,3-dimethylpyrrolidine-2,5-dione.
| Compound Name | 2,2-Dimethylsuccinimide |
|---|---|
| PubChem CID | 225678 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 3,3-dimethylpyrrolidine-2,5-dione |
| SMILES | CC1(CC(=O)NC1=O)C |
| InChI | InChI=1S/C6H9NO2/c1-6(2)3-4(8)7-5(6)9/h3H2,1-2H3,(H,7,8,9) |
| InChIKey | JVQHRYVXOWBSNS-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | 172 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|