About (S)-Ethosuximide
(S)-Ethosuximide (PubChem CID 10630591) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is (3S)-3-ethyl-3-methylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | (S)-Ethosuximide |
| PubChem CID | 10630591 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (3S)-3-ethyl-3-methylpyrrolidine-2,5-dione |
| SMILES | CC[C@]1(CC(=O)NC1=O)C |
| InChI | InChI=1S/C7H11NO2/c1-3-7(2)4-5(9)8-6(7)10/h3-4H2,1-2H3,(H,8,9,10)/t7-/m0/s1 |
| InChIKey | HAPOVYFOVVWLRS-ZETCQYMHSA-N |
| XLogP | 0.40 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 188 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (S)-Ethosuximide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-Ethosuximide?
The IUPAC name of (S)-Ethosuximide (CID 10630591) is (3S)-3-ethyl-3-methylpyrrolidine-2,5-dione.
What is the SMILES notation for (S)-Ethosuximide?
The canonical SMILES for (S)-Ethosuximide is CC[C@]1(CC(=O)NC1=O)C.
What is the InChIKey of (S)-Ethosuximide?
The InChIKey is HAPOVYFOVVWLRS-ZETCQYMHSA-N. The full InChI is InChI=1S/C7H11NO2/c1-3-7(2)4-5(9)8-6(7)10/h3-4H2,1-2H3,(H,8,9,10)/t7-/m0/s1.
What are the key properties of (S)-Ethosuximide?
(S)-Ethosuximide has a molecular weight of 141.17 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-Ethosuximide is sourced from PubChem (CID 10630591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).