About Ethosuximide metabolite III
Ethosuximide metabolite III (PubChem CID 101661945) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is 3-acetyl-3-methylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | Ethosuximide metabolite III |
| PubChem CID | 101661945 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 3-acetyl-3-methylpyrrolidine-2,5-dione |
| SMILES | CC(=O)C1(CC(=O)NC1=O)C |
| InChI | InChI=1S/C7H9NO3/c1-4(9)7(2)3-5(10)8-6(7)11/h3H2,1-2H3,(H,8,10,11) |
| InChIKey | SIZWFFGZMYBCOM-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 63.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | 246 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze Ethosuximide metabolite III with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ethosuximide metabolite III?
The IUPAC name of Ethosuximide metabolite III (CID 101661945) is 3-acetyl-3-methylpyrrolidine-2,5-dione.
What is the SMILES notation for Ethosuximide metabolite III?
The canonical SMILES for Ethosuximide metabolite III is CC(=O)C1(CC(=O)NC1=O)C.
What is the InChIKey of Ethosuximide metabolite III?
The InChIKey is SIZWFFGZMYBCOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c1-4(9)7(2)3-5(10)8-6(7)11/h3H2,1-2H3,(H,8,10,11).
What are the key properties of Ethosuximide metabolite III?
Ethosuximide metabolite III has a molecular weight of 155.15 g/mol, XLogP of -0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Ethosuximide metabolite III is sourced from PubChem (CID 101661945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).