About CID 70395227
CID 70395227 (PubChem CID 70395227) has the molecular formula C4H5LiNO2
and a molecular weight of 106.03 g/mol.
Molecular Properties
| Compound Name | CID 70395227 |
| PubChem CID | 70395227 |
| Molecular Formula | C4H5LiNO2 |
| Molecular Weight | 106.03 g/mol |
| Exact Mass | 106.05 |
| IUPAC Name | — |
| SMILES | O=C1CCC(=O)N1.[Li] |
| InChI | InChI=1S/C4H5NO2.Li/c6-3-1-2-4(7)5-3;/h1-2H2,(H,5,6,7); |
| InChIKey | BQHFFVOFLNRYRN-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.03 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 70395227 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70395227?
The IUPAC name of CID 70395227 (CID 70395227) is not available.
What is the SMILES notation for CID 70395227?
The canonical SMILES for CID 70395227 is O=C1CCC(=O)N1.[Li].
What is the InChIKey of CID 70395227?
The InChIKey is BQHFFVOFLNRYRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.Li/c6-3-1-2-4(7)5-3;/h1-2H2,(H,5,6,7);.
What are the key properties of CID 70395227?
CID 70395227 has a molecular weight of 106.03 g/mol, XLogP of -0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70395227 is sourced from PubChem (CID 70395227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).