C6H12ClNO2S — CID 22025404
dimethylsulfanium;pyrrolidine-2,5-dione;chloride (PubChem CID 22025404) has the molecular formula C6H12ClNO2S and a molecular weight of 197.69 g/mol. Its IUPAC name is dimethylsulfanium;pyrrolidine-2,5-dione;chloride.
| Compound Name | dimethylsulfanium;pyrrolidine-2,5-dione;chloride |
|---|---|
| PubChem CID | 22025404 |
| Molecular Formula | C6H12ClNO2S |
| Molecular Weight | 197.69 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | dimethylsulfanium;pyrrolidine-2,5-dione;chloride |
| SMILES | C[SH+]C.O=C1CCC(=O)N1.[Cl-] |
| InChI | InChI=1S/C4H5NO2.C2H6S.ClH/c6-3-1-2-4(7)5-3;1-3-2;/h1-2H2,(H,5,6,7);1-2H3;1H |
| InChIKey | FNHVKAQQUJKMSZ-UHFFFAOYSA-N |
| XLogP | -3.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.69 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|