About dimethylsulfanium;pyrrolidine-2,5-dione;chloride
dimethylsulfanium;pyrrolidine-2,5-dione;chloride (PubChem CID 22025404) has the molecular formula C6H12ClNO2S
and a molecular weight of 197.69 g/mol. Its IUPAC name is dimethylsulfanium;pyrrolidine-2,5-dione;chloride.
Molecular Properties
| Compound Name | dimethylsulfanium;pyrrolidine-2,5-dione;chloride |
| PubChem CID | 22025404 |
| Molecular Formula | C6H12ClNO2S |
| Molecular Weight | 197.69 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | dimethylsulfanium;pyrrolidine-2,5-dione;chloride |
| SMILES | C[SH+]C.O=C1CCC(=O)N1.[Cl-] |
| InChI | InChI=1S/C4H5NO2.C2H6S.ClH/c6-3-1-2-4(7)5-3;1-3-2;/h1-2H2,(H,5,6,7);1-2H3;1H |
| InChIKey | FNHVKAQQUJKMSZ-UHFFFAOYSA-N |
| XLogP | -3.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.69 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dimethylsulfanium;pyrrolidine-2,5-dione;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylsulfanium;pyrrolidine-2,5-dione;chloride?
The IUPAC name of dimethylsulfanium;pyrrolidine-2,5-dione;chloride (CID 22025404) is dimethylsulfanium;pyrrolidine-2,5-dione;chloride.
What is the SMILES notation for dimethylsulfanium;pyrrolidine-2,5-dione;chloride?
The canonical SMILES for dimethylsulfanium;pyrrolidine-2,5-dione;chloride is C[SH+]C.O=C1CCC(=O)N1.[Cl-].
What is the InChIKey of dimethylsulfanium;pyrrolidine-2,5-dione;chloride?
The InChIKey is FNHVKAQQUJKMSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.C2H6S.ClH/c6-3-1-2-4(7)5-3;1-3-2;/h1-2H2,(H,5,6,7);1-2H3;1H.
What are the key properties of dimethylsulfanium;pyrrolidine-2,5-dione;chloride?
dimethylsulfanium;pyrrolidine-2,5-dione;chloride has a molecular weight of 197.69 g/mol, XLogP of -3.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylsulfanium;pyrrolidine-2,5-dione;chloride is sourced from PubChem (CID 22025404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).