About ethane;propane;3-sulfanylpyrrolidine-2,5-dione
ethane;propane;3-sulfanylpyrrolidine-2,5-dione (PubChem CID 144975396) has the molecular formula C9H19NO2S
and a molecular weight of 205.32 g/mol. Its IUPAC name is ethane;propane;3-sulfanylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | ethane;propane;3-sulfanylpyrrolidine-2,5-dione |
| PubChem CID | 144975396 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | ethane;propane;3-sulfanylpyrrolidine-2,5-dione |
| SMILES | CC.CCC.O=C1CC(S)C(=O)N1 |
| InChI | InChI=1S/C4H5NO2S.C3H8.C2H6/c6-3-1-2(8)4(7)5-3;1-3-2;1-2/h2,8H,1H2,(H,5,6,7);3H2,1-2H3;1-2H3 |
| InChIKey | YXYNVLXUWRUGAL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;propane;3-sulfanylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propane;3-sulfanylpyrrolidine-2,5-dione?
The IUPAC name of ethane;propane;3-sulfanylpyrrolidine-2,5-dione (CID 144975396) is ethane;propane;3-sulfanylpyrrolidine-2,5-dione.
What is the SMILES notation for ethane;propane;3-sulfanylpyrrolidine-2,5-dione?
The canonical SMILES for ethane;propane;3-sulfanylpyrrolidine-2,5-dione is CC.CCC.O=C1CC(S)C(=O)N1.
What is the InChIKey of ethane;propane;3-sulfanylpyrrolidine-2,5-dione?
The InChIKey is YXYNVLXUWRUGAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2S.C3H8.C2H6/c6-3-1-2(8)4(7)5-3;1-3-2;1-2/h2,8H,1H2,(H,5,6,7);3H2,1-2H3;1-2H3.
What are the key properties of ethane;propane;3-sulfanylpyrrolidine-2,5-dione?
ethane;propane;3-sulfanylpyrrolidine-2,5-dione has a molecular weight of 205.32 g/mol, XLogP of 1.77, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propane;3-sulfanylpyrrolidine-2,5-dione is sourced from PubChem (CID 144975396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).