C9H19NO2S — CID 144975396
ethane;propane;3-sulfanylpyrrolidine-2,5-dione (PubChem CID 144975396) has the molecular formula C9H19NO2S and a molecular weight of 205.32 g/mol. Its IUPAC name is ethane;propane;3-sulfanylpyrrolidine-2,5-dione.
| Compound Name | ethane;propane;3-sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 144975396 |
| Molecular Formula | C9H19NO2S |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | ethane;propane;3-sulfanylpyrrolidine-2,5-dione |
| SMILES | CC.CCC.O=C1CC(S)C(=O)N1 |
| InChI | InChI=1S/C4H5NO2S.C3H8.C2H6/c6-3-1-2(8)4(7)5-3;1-3-2;1-2/h2,8H,1H2,(H,5,6,7);3H2,1-2H3;1-2H3 |
| InChIKey | YXYNVLXUWRUGAL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|