C8H14N2O2 — CID 126984968
4-methyl-3-propylpiperazine-2,6-dione (PubChem CID 126984968) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 4-methyl-3-propylpiperazine-2,6-dione.
| Compound Name | 4-methyl-3-propylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 126984968 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 4-methyl-3-propylpiperazine-2,6-dione |
| SMILES | CCCC1C(=O)NC(=O)CN1C |
| InChI | InChI=1S/C8H14N2O2/c1-3-4-6-8(12)9-7(11)5-10(6)2/h6H,3-5H2,1-2H3,(H,9,11,12) |
| InChIKey | FBJKHNIJBZLULI-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|