C10H13NO4 — CID 141166852
1-(2,5-dioxopyrrolidin-3-yl)ethyl 2-methylprop-2-enoate (PubChem CID 141166852) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 1-(2,5-dioxopyrrolidin-3-yl)ethyl 2-methylprop-2-enoate.
| Compound Name | 1-(2,5-dioxopyrrolidin-3-yl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141166852 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 1-(2,5-dioxopyrrolidin-3-yl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)C1CC(=O)NC1=O |
| InChI | InChI=1S/C10H13NO4/c1-5(2)10(14)15-6(3)7-4-8(12)11-9(7)13/h6-7H,1,4H2,2-3H3,(H,11,12,13) |
| InChIKey | LCRFLQXTFOGXCE-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|