About propan-2-yl 2-methylprop-2-enoate;2-propylcyclopropan-1-one
propan-2-yl 2-methylprop-2-enoate;2-propylcyclopropan-1-one (PubChem CID 18784426) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is propan-2-yl 2-methylprop-2-enoate;2-propylcyclopropan-1-one.
Molecular Properties
| Compound Name | propan-2-yl 2-methylprop-2-enoate;2-propylcyclopropan-1-one |
| PubChem CID | 18784426 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | propan-2-yl 2-methylprop-2-enoate;2-propylcyclopropan-1-one |
| SMILES | C=C(C)C(=O)OC(C)C.CCCC1CC1=O |
| InChI | InChI=1S/C7H12O2.C6H10O/c1-5(2)7(8)9-6(3)4;1-2-3-5-4-6(5)7/h6H,1H2,2-4H3;5H,2-4H2,1H3 |
| InChIKey | QIAPFIJZQCTBSB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-methylprop-2-enoate;2-propylcyclopropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-methylprop-2-enoate;2-propylcyclopropan-1-one?
The IUPAC name of propan-2-yl 2-methylprop-2-enoate;2-propylcyclopropan-1-one (CID 18784426) is propan-2-yl 2-methylprop-2-enoate;2-propylcyclopropan-1-one.
What is the SMILES notation for propan-2-yl 2-methylprop-2-enoate;2-propylcyclopropan-1-one?
The canonical SMILES for propan-2-yl 2-methylprop-2-enoate;2-propylcyclopropan-1-one is C=C(C)C(=O)OC(C)C.CCCC1CC1=O.
What is the InChIKey of propan-2-yl 2-methylprop-2-enoate;2-propylcyclopropan-1-one?
The InChIKey is QIAPFIJZQCTBSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2.C6H10O/c1-5(2)7(8)9-6(3)4;1-2-3-5-4-6(5)7/h6H,1H2,2-4H3;5H,2-4H2,1H3.
What are the key properties of propan-2-yl 2-methylprop-2-enoate;2-propylcyclopropan-1-one?
propan-2-yl 2-methylprop-2-enoate;2-propylcyclopropan-1-one has a molecular weight of 226.32 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-methylprop-2-enoate;2-propylcyclopropan-1-one is sourced from PubChem (CID 18784426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).