C9H11N3O5 — CID 174497886
1-(2,4,6-trioxo-1,3,5-triazinan-1-yl)ethyl 2-methylprop-2-enoate (PubChem CID 174497886) has the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. Its IUPAC name is 1-(2,4,6-trioxo-1,3,5-triazinan-1-yl)ethyl 2-methylprop-2-enoate.
| Compound Name | 1-(2,4,6-trioxo-1,3,5-triazinan-1-yl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174497886 |
| Molecular Formula | C9H11N3O5 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1-(2,4,6-trioxo-1,3,5-triazinan-1-yl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)n1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H11N3O5/c1-4(2)6(13)17-5(3)12-8(15)10-7(14)11-9(12)16/h5H,1H2,2-3H3,(H2,10,11,14,15,16) |
| InChIKey | LQCIUXOEQMYZSV-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|