C8H9N3O5 — CID 67262883
methyl 2-methyl-3-(2,4,6-trioxo-1,3,5-triazinan-1-yl)prop-2-enoate (PubChem CID 67262883) has the molecular formula C8H9N3O5 and a molecular weight of 227.18 g/mol. Its IUPAC name is methyl 2-methyl-3-(2,4,6-trioxo-1,3,5-triazinan-1-yl)prop-2-enoate.
| Compound Name | methyl 2-methyl-3-(2,4,6-trioxo-1,3,5-triazinan-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 67262883 |
| Molecular Formula | C8H9N3O5 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | methyl 2-methyl-3-(2,4,6-trioxo-1,3,5-triazinan-1-yl)prop-2-enoate |
| SMILES | COC(=O)C(C)=Cn1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H9N3O5/c1-4(5(12)16-2)3-11-7(14)9-6(13)10-8(11)15/h3H,1-2H3,(H2,9,10,13,14,15) |
| InChIKey | NQSGLDHQCJZICN-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|