C15H21N3O9 — CID 139833645
1-[3,5-bis(1-acetyloxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl acetate (PubChem CID 139833645) has the molecular formula C15H21N3O9 and a molecular weight of 387.35 g/mol. Its IUPAC name is 1-[3,5-bis(1-acetyloxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl acetate.
| Compound Name | 1-[3,5-bis(1-acetyloxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 139833645 |
| Molecular Formula | C15H21N3O9 |
| Molecular Weight | 387.35 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-[3,5-bis(1-acetyloxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl acetate |
| SMILES | CC(=O)OC(C)n1c(=O)n(C(C)OC(C)=O)c(=O)n(C(C)OC(C)=O)c1=O |
| InChI | InChI=1S/C15H21N3O9/c1-7(25-10(4)19)16-13(22)17(8(2)26-11(5)20)15(24)18(14(16)23)9(3)27-12(6)21/h7-9H,1-6H3 |
| InChIKey | KBLFUORLKVKXML-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.35 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|