About propan-2-yl acetate;hydrochloride
propan-2-yl acetate;hydrochloride (PubChem CID 87336432) has the molecular formula C5H11ClO2
and a molecular weight of 138.59 g/mol. Its IUPAC name is propan-2-yl acetate;hydrochloride.
Molecular Properties
| Compound Name | propan-2-yl acetate;hydrochloride |
| PubChem CID | 87336432 |
| Molecular Formula | C5H11ClO2 |
| Molecular Weight | 138.59 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | propan-2-yl acetate;hydrochloride |
| SMILES | CC(=O)OC(C)C.Cl |
| InChI | InChI=1S/C5H10O2.ClH/c1-4(2)7-5(3)6;/h4H,1-3H3;1H |
| InChIKey | VDBGYEHAYGSJTP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.59 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propan-2-yl acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl acetate;hydrochloride?
The IUPAC name of propan-2-yl acetate;hydrochloride (CID 87336432) is propan-2-yl acetate;hydrochloride.
What is the SMILES notation for propan-2-yl acetate;hydrochloride?
The canonical SMILES for propan-2-yl acetate;hydrochloride is CC(=O)OC(C)C.Cl.
What is the InChIKey of propan-2-yl acetate;hydrochloride?
The InChIKey is VDBGYEHAYGSJTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.ClH/c1-4(2)7-5(3)6;/h4H,1-3H3;1H.
What are the key properties of propan-2-yl acetate;hydrochloride?
propan-2-yl acetate;hydrochloride has a molecular weight of 138.59 g/mol, XLogP of 1.38, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl acetate;hydrochloride is sourced from PubChem (CID 87336432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).