About N-methoxymethanamine;propan-2-yl acetate
N-methoxymethanamine;propan-2-yl acetate (PubChem CID 158428721) has the molecular formula C7H17NO3
and a molecular weight of 163.22 g/mol. Its IUPAC name is N-methoxymethanamine;propan-2-yl acetate.
Molecular Properties
| Compound Name | N-methoxymethanamine;propan-2-yl acetate |
| PubChem CID | 158428721 |
| Molecular Formula | C7H17NO3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | N-methoxymethanamine;propan-2-yl acetate |
| SMILES | CC(=O)OC(C)C.CNOC |
| InChI | InChI=1S/C5H10O2.C2H7NO/c1-4(2)7-5(3)6;1-3-4-2/h4H,1-3H3;3H,1-2H3 |
| InChIKey | HBJQGHGKRZZZGS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxymethanamine;propan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxymethanamine;propan-2-yl acetate?
The IUPAC name of N-methoxymethanamine;propan-2-yl acetate (CID 158428721) is N-methoxymethanamine;propan-2-yl acetate.
What is the SMILES notation for N-methoxymethanamine;propan-2-yl acetate?
The canonical SMILES for N-methoxymethanamine;propan-2-yl acetate is CC(=O)OC(C)C.CNOC.
What is the InChIKey of N-methoxymethanamine;propan-2-yl acetate?
The InChIKey is HBJQGHGKRZZZGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.C2H7NO/c1-4(2)7-5(3)6;1-3-4-2/h4H,1-3H3;3H,1-2H3.
What are the key properties of N-methoxymethanamine;propan-2-yl acetate?
N-methoxymethanamine;propan-2-yl acetate has a molecular weight of 163.22 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxymethanamine;propan-2-yl acetate is sourced from PubChem (CID 158428721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).