About 3-oxobutanoic acid;propan-2-yl acetate
3-oxobutanoic acid;propan-2-yl acetate (PubChem CID 160874016) has the molecular formula C9H16O5
and a molecular weight of 204.22 g/mol. Its IUPAC name is 3-oxobutanoic acid;propan-2-yl acetate.
Molecular Properties
| Compound Name | 3-oxobutanoic acid;propan-2-yl acetate |
| PubChem CID | 160874016 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-oxobutanoic acid;propan-2-yl acetate |
| SMILES | CC(=O)CC(=O)O.CC(=O)OC(C)C |
| InChI | InChI=1S/C5H10O2.C4H6O3/c1-4(2)7-5(3)6;1-3(5)2-4(6)7/h4H,1-3H3;2H2,1H3,(H,6,7) |
| InChIKey | SMDGXNLDVRLJMG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxobutanoic acid;propan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxobutanoic acid;propan-2-yl acetate?
The IUPAC name of 3-oxobutanoic acid;propan-2-yl acetate (CID 160874016) is 3-oxobutanoic acid;propan-2-yl acetate.
What is the SMILES notation for 3-oxobutanoic acid;propan-2-yl acetate?
The canonical SMILES for 3-oxobutanoic acid;propan-2-yl acetate is CC(=O)CC(=O)O.CC(=O)OC(C)C.
What is the InChIKey of 3-oxobutanoic acid;propan-2-yl acetate?
The InChIKey is SMDGXNLDVRLJMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2.C4H6O3/c1-4(2)7-5(3)6;1-3(5)2-4(6)7/h4H,1-3H3;2H2,1H3,(H,6,7).
What are the key properties of 3-oxobutanoic acid;propan-2-yl acetate?
3-oxobutanoic acid;propan-2-yl acetate has a molecular weight of 204.22 g/mol, XLogP of 1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobutanoic acid;propan-2-yl acetate is sourced from PubChem (CID 160874016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).