C9H16O2 — CID 122645067
methyl (E)-2,3,4-trimethylpent-2-enoate (PubChem CID 122645067) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is methyl (E)-2,3,4-trimethylpent-2-enoate.
| Compound Name | methyl (E)-2,3,4-trimethylpent-2-enoate |
|---|---|
| PubChem CID | 122645067 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | methyl (E)-2,3,4-trimethylpent-2-enoate |
| SMILES | COC(=O)/C(C)=C(\C)C(C)C |
| InChI | InChI=1S/C9H16O2/c1-6(2)7(3)8(4)9(10)11-5/h6H,1-5H3/b8-7+ |
| InChIKey | GSFJWHRSCSKADY-BQYQJAHWSA-N |
| XLogP | 2.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|