C11H20O — CID 159203948
2,4,5,6-tetramethylhept-4-en-3-one (PubChem CID 159203948) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 2,4,5,6-tetramethylhept-4-en-3-one.
| Compound Name | 2,4,5,6-tetramethylhept-4-en-3-one |
|---|---|
| PubChem CID | 159203948 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 2,4,5,6-tetramethylhept-4-en-3-one |
| SMILES | CC(C(=O)C(C)C)=C(C)C(C)C |
| InChI | InChI=1S/C11H20O/c1-7(2)9(5)10(6)11(12)8(3)4/h7-8H,1-6H3 |
| InChIKey | RFVDIVRULQWGJV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|