C21H44 — CID 161097810
methane;(Z)-2,3,4,5-tetramethylhex-3-ene;(E)-2,3,4,5-tetramethylhex-3-ene (PubChem CID 161097810) has the molecular formula C21H44 and a molecular weight of 296.58 g/mol. Its IUPAC name is methane;(Z)-2,3,4,5-tetramethylhex-3-ene;(E)-2,3,4,5-tetramethylhex-3-ene.
| Compound Name | methane;(Z)-2,3,4,5-tetramethylhex-3-ene;(E)-2,3,4,5-tetramethylhex-3-ene |
|---|---|
| PubChem CID | 161097810 |
| Molecular Formula | C21H44 |
| Molecular Weight | 296.58 g/mol |
| Exact Mass | 296.34 |
| IUPAC Name | methane;(Z)-2,3,4,5-tetramethylhex-3-ene;(E)-2,3,4,5-tetramethylhex-3-ene |
| SMILES | C.C/C(=C(/C)C(C)C)C(C)C.C/C(=C(\C)C(C)C)C(C)C |
| InChI | InChI=1S/2C10H20.CH4/c2*1-7(2)9(5)10(6)8(3)4;/h2*7-8H,1-6H3;1H4/b10-9+;10-9-; |
| InChIKey | UIAGFUPOYHMWSH-HUGPZQPHSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.58 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|