C7H14S — CID 176996545
(Z)-3,4-dimethylpent-2-ene-2-thiol (PubChem CID 176996545) has the molecular formula C7H14S and a molecular weight of 130.26 g/mol. Its IUPAC name is (Z)-3,4-dimethylpent-2-ene-2-thiol.
| Compound Name | (Z)-3,4-dimethylpent-2-ene-2-thiol |
|---|---|
| PubChem CID | 176996545 |
| Molecular Formula | C7H14S |
| Molecular Weight | 130.26 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | (Z)-3,4-dimethylpent-2-ene-2-thiol |
| SMILES | C/C(S)=C(\C)C(C)C |
| InChI | InChI=1S/C7H14S/c1-5(2)6(3)7(4)8/h5,8H,1-4H3/b7-6- |
| InChIKey | MFVQFKZQFNWICO-SREVYHEPSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|