C8H17N — CID 59961887
(Z)-N,3,4-trimethylpent-2-en-2-amine (PubChem CID 59961887) has the molecular formula C8H17N and a molecular weight of 127.23 g/mol. Its IUPAC name is (Z)-N,3,4-trimethylpent-2-en-2-amine.
| Compound Name | (Z)-N,3,4-trimethylpent-2-en-2-amine |
|---|---|
| PubChem CID | 59961887 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | (Z)-N,3,4-trimethylpent-2-en-2-amine |
| SMILES | CN/C(C)=C(/C)C(C)C |
| InChI | InChI=1S/C8H17N/c1-6(2)7(3)8(4)9-5/h6,9H,1-5H3/b8-7- |
| InChIKey | LKWYQCJUHADBLZ-FPLPWBNLSA-N |
| XLogP | 2.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |