C21H46 — CID 162024182
methane;2,3,4,5-tetramethylhexane;(Z)-2,3,4,5-tetramethylhex-3-ene (PubChem CID 162024182) has the molecular formula C21H46 and a molecular weight of 298.60 g/mol. Its IUPAC name is methane;2,3,4,5-tetramethylhexane;(Z)-2,3,4,5-tetramethylhex-3-ene.
| Compound Name | methane;2,3,4,5-tetramethylhexane;(Z)-2,3,4,5-tetramethylhex-3-ene |
|---|---|
| PubChem CID | 162024182 |
| Molecular Formula | C21H46 |
| Molecular Weight | 298.60 g/mol |
| Exact Mass | 298.36 |
| IUPAC Name | methane;2,3,4,5-tetramethylhexane;(Z)-2,3,4,5-tetramethylhex-3-ene |
| SMILES | C.C/C(=C(\C)C(C)C)C(C)C.CC(C)C(C)C(C)C(C)C |
| InChI | InChI=1S/C10H22.C10H20.CH4/c2*1-7(2)9(5)10(6)8(3)4;/h7-10H,1-6H3;7-8H,1-6H3;1H4/b;10-9-; |
| InChIKey | YVDMGJCQFOWQBH-MEILSSRFSA-N |
| XLogP | 7.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.60 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|