C3H6S3 — CID 88897307
prop-1-ene-1,1,2-trithiol (PubChem CID 88897307) has the molecular formula C3H6S3 and a molecular weight of 138.28 g/mol. Its IUPAC name is prop-1-ene-1,1,2-trithiol.
| Compound Name | prop-1-ene-1,1,2-trithiol |
|---|---|
| PubChem CID | 88897307 |
| Molecular Formula | C3H6S3 |
| Molecular Weight | 138.28 g/mol |
| Exact Mass | 137.96 |
| IUPAC Name | prop-1-ene-1,1,2-trithiol |
| SMILES | CC(S)=C(S)S |
| InChI | InChI=1S/C3H6S3/c1-2(4)3(5)6/h4-6H,1H3 |
| InChIKey | UOAOSADEADZRAZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|