About (E)-1,2-diaminoprop-1-ene-1-thiol
(E)-1,2-diaminoprop-1-ene-1-thiol (PubChem CID 143171578) has the molecular formula C3H8N2S
and a molecular weight of 104.18 g/mol. Its IUPAC name is (E)-1,2-diaminoprop-1-ene-1-thiol.
Molecular Properties
| Compound Name | (E)-1,2-diaminoprop-1-ene-1-thiol |
| PubChem CID | 143171578 |
| Molecular Formula | C3H8N2S |
| Molecular Weight | 104.18 g/mol |
| Exact Mass | 104.04 |
| IUPAC Name | (E)-1,2-diaminoprop-1-ene-1-thiol |
| SMILES | C/C(N)=C(/N)S |
| InChI | InChI=1S/C3H8N2S/c1-2(4)3(5)6/h6H,4-5H2,1H3/b3-2+ |
| InChIKey | HHBZAPLUOVDJET-NSCUHMNNSA-N |
| XLogP | 0.02 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.18 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,2-diaminoprop-1-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,2-diaminoprop-1-ene-1-thiol?
The IUPAC name of (E)-1,2-diaminoprop-1-ene-1-thiol (CID 143171578) is (E)-1,2-diaminoprop-1-ene-1-thiol.
What is the SMILES notation for (E)-1,2-diaminoprop-1-ene-1-thiol?
The canonical SMILES for (E)-1,2-diaminoprop-1-ene-1-thiol is C/C(N)=C(/N)S.
What is the InChIKey of (E)-1,2-diaminoprop-1-ene-1-thiol?
The InChIKey is HHBZAPLUOVDJET-NSCUHMNNSA-N. The full InChI is InChI=1S/C3H8N2S/c1-2(4)3(5)6/h6H,4-5H2,1H3/b3-2+.
What are the key properties of (E)-1,2-diaminoprop-1-ene-1-thiol?
(E)-1,2-diaminoprop-1-ene-1-thiol has a molecular weight of 104.18 g/mol, XLogP of 0.02, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,2-diaminoprop-1-ene-1-thiol is sourced from PubChem (CID 143171578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).