C5H10N2S — CID 147166745
(2Z)-3,4-diaminopenta-2,4-diene-2-thiol (PubChem CID 147166745) has the molecular formula C5H10N2S and a molecular weight of 130.22 g/mol. Its IUPAC name is (2Z)-3,4-diaminopenta-2,4-diene-2-thiol.
| Compound Name | (2Z)-3,4-diaminopenta-2,4-diene-2-thiol |
|---|---|
| PubChem CID | 147166745 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (2Z)-3,4-diaminopenta-2,4-diene-2-thiol |
| SMILES | C=C(N)/C(N)=C(\C)S |
| InChI | InChI=1S/C5H10N2S/c1-3(6)5(7)4(2)8/h8H,1,6-7H2,2H3/b5-4- |
| InChIKey | BWXRYFRYHSODEB-PLNGDYQASA-N |
| XLogP | 0.58 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|